C27H35FN3O7Si+ — CID 142405274
2-[[4-[4-[(2S)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-fluorophenoxy]-3-formylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium (PubChem CID 142405274) has the molecular formula C27H35FN3O7Si+ and a molecular weight of 560.68 g/mol. Its IUPAC name is 2-[[4-[4-[(2S)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-fluorophenoxy]-3-formylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium.
| Compound Name | 2-[[4-[4-[(2S)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-fluorophenoxy]-3-formylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium |
|---|---|
| PubChem CID | 142405274 |
| Molecular Formula | C27H35FN3O7Si+ |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 2-[[4-[4-[(2S)-2-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2-fluorophenoxy]-3-formylpyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-dimethylsilanylium |
| SMILES | C[SiH2+](C)CCOCn1cc(C=O)c2c(Oc3ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)O)cc3F)ccnc21 |
| InChI | InChI=1S/C27H35FN3O7Si/c1-27(2,3)38-26(35)30-20(25(33)34)13-17-6-7-21(19(28)12-17)37-22-8-9-29-24-23(22)18(15-32)14-31(24)16-36-10-11-39(4)5/h6-9,12,14-15,20H,10-11,13,16,39H2,1-5H3,(H,30,35)(H,33,34)/q+1/t20-/m0/s1 |
| InChIKey | ZVLBPXKVVAYGNS-FQEVSTJZSA-N |
| XLogP | 4.49 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|