C20H23F5O4S2 — CID 142405390
[3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate (PubChem CID 142405390) has the molecular formula C20H23F5O4S2 and a molecular weight of 486.52 g/mol. Its IUPAC name is [3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate.
| Compound Name | [3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142405390 |
| Molecular Formula | C20H23F5O4S2 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | [3-[tert-butyl(diphenyl)-λ4-sulfanyl]oxy-2,2-difluoropropyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)S(OCC(F)(F)COS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23F5O4S2/c1-18(2,3)30(16-10-6-4-7-11-16,17-12-8-5-9-13-17)28-14-19(21,22)15-29-31(26,27)20(23,24)25/h4-13H,14-15H2,1-3H3 |
| InChIKey | NPKJETWFBINGTA-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|