C19H16ClF3O3 — CID 142405831
ethyl 4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoate (PubChem CID 142405831) has the molecular formula C19H16ClF3O3 and a molecular weight of 384.78 g/mol. Its IUPAC name is ethyl 4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoate.
| Compound Name | ethyl 4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 142405831 |
| Molecular Formula | C19H16ClF3O3 |
| Molecular Weight | 384.78 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | ethyl 4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoate |
| SMILES | CCOC(=O)CCC(C(=O)c1ccc(F)cc1)c1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C19H16ClF3O3/c1-2-26-17(24)8-7-14(15-9-13(22)10-16(23)18(15)20)19(25)11-3-5-12(21)6-4-11/h3-6,9-10,14H,2,7-8H2,1H3 |
| InChIKey | ZZGGGLDZCLQWNU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.78 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|