C17H12ClF3O3 — CID 142405830
4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoic acid (PubChem CID 142405830) has the molecular formula C17H12ClF3O3 and a molecular weight of 356.73 g/mol. Its IUPAC name is 4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoic acid.
| Compound Name | 4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142405830 |
| Molecular Formula | C17H12ClF3O3 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 4-(2-chloro-3,5-difluorophenyl)-5-(4-fluorophenyl)-5-oxopentanoic acid |
| SMILES | O=C(O)CCC(C(=O)c1ccc(F)cc1)c1cc(F)cc(F)c1Cl |
| InChI | InChI=1S/C17H12ClF3O3/c18-16-13(7-11(20)8-14(16)21)12(5-6-15(22)23)17(24)9-1-3-10(19)4-2-9/h1-4,7-8,12H,5-6H2,(H,22,23) |
| InChIKey | FDGHGKYAMMRNNQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|