C24H28N6O4 — CID 142406701
N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-methoxybenzamide (PubChem CID 142406701) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-methoxybenzamide.
| Compound Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 142406701 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-[4-[(7,8-dimethoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-2-methoxybenzamide |
| SMILES | COc1cc2nc(NCCCCNC(=O)c3ccccc3OC)c3nnc(C)n3c2cc1OC |
| InChI | InChI=1S/C24H28N6O4/c1-15-28-29-23-22(27-17-13-20(33-3)21(34-4)14-18(17)30(15)23)25-11-7-8-12-26-24(31)16-9-5-6-10-19(16)32-2/h5-6,9-10,13-14H,7-8,11-12H2,1-4H3,(H,25,27)(H,26,31) |
| InChIKey | ISJJSWDZOXGYBS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|