C22H43N3O — CID 142406955
ethane;N-ethyl-N-(2-methylpropyl)acetamide;3-methyl-2H-indazole (PubChem CID 142406955) has the molecular formula C22H43N3O and a molecular weight of 365.61 g/mol. Its IUPAC name is ethane;N-ethyl-N-(2-methylpropyl)acetamide;3-methyl-2H-indazole.
| Compound Name | ethane;N-ethyl-N-(2-methylpropyl)acetamide;3-methyl-2H-indazole |
|---|---|
| PubChem CID | 142406955 |
| Molecular Formula | C22H43N3O |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.34 |
| IUPAC Name | ethane;N-ethyl-N-(2-methylpropyl)acetamide;3-methyl-2H-indazole |
| SMILES | CC.CC.CC.CCN(CC(C)C)C(C)=O.Cc1[nH]nc2ccccc12 |
| InChI | InChI=1S/C8H8N2.C8H17NO.3C2H6/c1-6-7-4-2-3-5-8(7)10-9-6;1-5-9(8(4)10)6-7(2)3;3*1-2/h2-5H,1H3,(H,9,10);7H,5-6H2,1-4H3;3*1-2H3 |
| InChIKey | IUTVRQAWJXKTCM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |