C12H15N3O2 — CID 142408070
methyl (E)-3-(1,4-dimethyl-2,3-dihydrobenzotriazol-5-yl)prop-2-enoate (PubChem CID 142408070) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is methyl (E)-3-(1,4-dimethyl-2,3-dihydrobenzotriazol-5-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(1,4-dimethyl-2,3-dihydrobenzotriazol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 142408070 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | methyl (E)-3-(1,4-dimethyl-2,3-dihydrobenzotriazol-5-yl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1C)NNN2C |
| InChI | InChI=1S/C12H15N3O2/c1-8-9(5-7-11(16)17-3)4-6-10-12(8)13-14-15(10)2/h4-7,13-14H,1-3H3/b7-5+ |
| InChIKey | YLOVNQGPHNASEL-FNORWQNLSA-N |
| XLogP | 1.46 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|