C22H27NO — CID 142409184
3-[(4-ethenylphenyl)methyl-[(2E,3Z)-2-prop-2-ynylidenehepta-3,6-dienyl]amino]propan-1-ol (PubChem CID 142409184) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 3-[(4-ethenylphenyl)methyl-[(2E,3Z)-2-prop-2-ynylidenehepta-3,6-dienyl]amino]propan-1-ol.
| Compound Name | 3-[(4-ethenylphenyl)methyl-[(2E,3Z)-2-prop-2-ynylidenehepta-3,6-dienyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 142409184 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-[(4-ethenylphenyl)methyl-[(2E,3Z)-2-prop-2-ynylidenehepta-3,6-dienyl]amino]propan-1-ol |
| SMILES | C#C/C=C(\C=C/CC=C)CN(CCCO)Cc1ccc(C=C)cc1 |
| InChI | InChI=1S/C22H27NO/c1-4-7-8-11-21(10-5-2)18-23(16-9-17-24)19-22-14-12-20(6-3)13-15-22/h2,4,6,8,10-15,24H,1,3,7,9,16-19H2/b11-8-,21-10+ |
| InChIKey | UYGWVVAUMJYDKK-XRXJUDGPSA-N |
| XLogP | 4.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|