C15H18N4O3S — CID 142410311
2-[(2E)-2-[(E)-(5-tert-butyl-2-pyridinyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 142410311) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-(5-tert-butyl-2-pyridinyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(E)-(5-tert-butyl-2-pyridinyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 142410311 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[(2E)-2-[(E)-(5-tert-butyl-2-pyridinyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CC(C)(C)c1ccc(/C=N/N=C2\NC(=O)C(CC(=O)O)S2)nc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-15(2,3)9-4-5-10(16-7-9)8-17-19-14-18-13(22)11(23-14)6-12(20)21/h4-5,7-8,11H,6H2,1-3H3,(H,20,21)(H,18,19,22)/b17-8+ |
| InChIKey | NBBQKFARLPNUNB-CAOOACKPSA-N |
| XLogP | 1.78 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|