C16H16F3N3O4S — CID 168622004
2-[4-oxo-2-[[2-propoxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 168622004) has the molecular formula C16H16F3N3O4S and a molecular weight of 403.38 g/mol. Its IUPAC name is 2-[4-oxo-2-[[2-propoxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[4-oxo-2-[[2-propoxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 168622004 |
| Molecular Formula | C16H16F3N3O4S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[4-oxo-2-[[2-propoxy-5-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1C=NN=C1NC(=O)C(CC(=O)O)S1 |
| InChI | InChI=1S/C16H16F3N3O4S/c1-2-5-26-11-4-3-10(16(17,18)19)6-9(11)8-20-22-15-21-14(25)12(27-15)7-13(23)24/h3-4,6,8,12H,2,5,7H2,1H3,(H,23,24)(H,21,22,25) |
| InChIKey | DHRMRIWCEWZBDC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|