C23H27NO3 — CID 142415751
ethyl 10-cyclopropyl-6-methyl-2-oxo-6-propan-2-yl-7H-benzo[a]quinolizine-3-carboxylate (PubChem CID 142415751) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is ethyl 10-cyclopropyl-6-methyl-2-oxo-6-propan-2-yl-7H-benzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 10-cyclopropyl-6-methyl-2-oxo-6-propan-2-yl-7H-benzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 142415751 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl 10-cyclopropyl-6-methyl-2-oxo-6-propan-2-yl-7H-benzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(C3CC3)ccc1CC2(C)C(C)C |
| InChI | InChI=1S/C23H27NO3/c1-5-27-22(26)19-13-24-20(11-21(19)25)18-10-16(15-6-7-15)8-9-17(18)12-23(24,4)14(2)3/h8-11,13-15H,5-7,12H2,1-4H3 |
| InChIKey | VVYOHNLFYFHKTG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |