C26H31F2NO3Si — CID 142415908
ethyl 10-(difluoromethyl)-6-methyl-2-oxo-6-propan-2-yl-9-(2-trimethylsilylethynyl)-7H-benzo[a]quinolizine-3-carboxylate (PubChem CID 142415908) has the molecular formula C26H31F2NO3Si and a molecular weight of 471.62 g/mol. Its IUPAC name is ethyl 10-(difluoromethyl)-6-methyl-2-oxo-6-propan-2-yl-9-(2-trimethylsilylethynyl)-7H-benzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 10-(difluoromethyl)-6-methyl-2-oxo-6-propan-2-yl-9-(2-trimethylsilylethynyl)-7H-benzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 142415908 |
| Molecular Formula | C26H31F2NO3Si |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | ethyl 10-(difluoromethyl)-6-methyl-2-oxo-6-propan-2-yl-9-(2-trimethylsilylethynyl)-7H-benzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(C(F)F)c(C#C[Si](C)(C)C)cc1CC2(C)C(C)C |
| InChI | InChI=1S/C26H31F2NO3Si/c1-8-32-25(31)21-15-29-22(13-23(21)30)19-12-20(24(27)28)17(9-10-33(5,6)7)11-18(19)14-26(29,4)16(2)3/h11-13,15-16,24H,8,14H2,1-7H3 |
| InChIKey | WNVLDQSZPNTDFW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|