C19H23FN6O5 — CID 142416592
tert-butyl N-[2-[[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-1,2,5-oxadiazol-3-yl]amino]ethyl]carbamate;3-fluorobicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 142416592) has the molecular formula C19H23FN6O5 and a molecular weight of 434.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-1,2,5-oxadiazol-3-yl]amino]ethyl]carbamate;3-fluorobicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | tert-butyl N-[2-[[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-1,2,5-oxadiazol-3-yl]amino]ethyl]carbamate;3-fluorobicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 142416592 |
| Molecular Formula | C19H23FN6O5 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | tert-butyl N-[2-[[4-(5-oxo-4H-1,2,4-oxadiazol-3-yl)-1,2,5-oxadiazol-3-yl]amino]ethyl]carbamate;3-fluorobicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | CC(C)(C)OC(=O)NCCNc1nonc1-c1noc(=O)[nH]1.Fc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C11H16N6O5.C8H7F/c1-11(2,3)20-9(18)13-5-4-12-7-6(15-22-17-7)8-14-10(19)21-16-8;9-8-4-3-6-1-2-7(6)5-8/h4-5H2,1-3H3,(H,12,17)(H,13,18)(H,14,16,19);3-5H,1-2H2 |
| InChIKey | DBYUXNMAEGFKPP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 148.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|