C16H26N2 — CID 142417039
5-[(6R)-2,6-dimethylpiperidin-1-yl]-1,2,3,4,4a,8a-hexahydroisoquinoline (PubChem CID 142417039) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 5-[(6R)-2,6-dimethylpiperidin-1-yl]-1,2,3,4,4a,8a-hexahydroisoquinoline.
| Compound Name | 5-[(6R)-2,6-dimethylpiperidin-1-yl]-1,2,3,4,4a,8a-hexahydroisoquinoline |
|---|---|
| PubChem CID | 142417039 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 5-[(6R)-2,6-dimethylpiperidin-1-yl]-1,2,3,4,4a,8a-hexahydroisoquinoline |
| SMILES | CC1CCC[C@@H](C)N1C1=CC=CC2CNCCC12 |
| InChI | InChI=1S/C16H26N2/c1-12-5-3-6-13(2)18(12)16-8-4-7-14-11-17-10-9-15(14)16/h4,7-8,12-15,17H,3,5-6,9-11H2,1-2H3/t12-,13?,14?,15?/m1/s1 |
| InChIKey | DNOYOCKTDUCETE-AUXXQLBISA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |