C18H26ClNO4S — CID 142417265
2-chloro-N,N-dimethyl-4-[4-methyl-2-(2-methylpropanoyl)-3-oxopentyl]benzenesulfonamide (PubChem CID 142417265) has the molecular formula C18H26ClNO4S and a molecular weight of 387.93 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-4-[4-methyl-2-(2-methylpropanoyl)-3-oxopentyl]benzenesulfonamide.
| Compound Name | 2-chloro-N,N-dimethyl-4-[4-methyl-2-(2-methylpropanoyl)-3-oxopentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142417265 |
| Molecular Formula | C18H26ClNO4S |
| Molecular Weight | 387.93 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-chloro-N,N-dimethyl-4-[4-methyl-2-(2-methylpropanoyl)-3-oxopentyl]benzenesulfonamide |
| SMILES | CC(C)C(=O)C(Cc1ccc(S(=O)(=O)N(C)C)c(Cl)c1)C(=O)C(C)C |
| InChI | InChI=1S/C18H26ClNO4S/c1-11(2)17(21)14(18(22)12(3)4)9-13-7-8-16(15(19)10-13)25(23,24)20(5)6/h7-8,10-12,14H,9H2,1-6H3 |
| InChIKey | GIOCOTYCKQSIQW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.93 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|