C25H34N4O2 — CID 142417875
2-N-methyl-6-(1-phenylethyl)-4-N-propylpyridine-2,4-dicarboxamide;N-[(Z)-prop-1-enyl]propan-2-imine (PubChem CID 142417875) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-N-methyl-6-(1-phenylethyl)-4-N-propylpyridine-2,4-dicarboxamide;N-[(Z)-prop-1-enyl]propan-2-imine.
| Compound Name | 2-N-methyl-6-(1-phenylethyl)-4-N-propylpyridine-2,4-dicarboxamide;N-[(Z)-prop-1-enyl]propan-2-imine |
|---|---|
| PubChem CID | 142417875 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-N-methyl-6-(1-phenylethyl)-4-N-propylpyridine-2,4-dicarboxamide;N-[(Z)-prop-1-enyl]propan-2-imine |
| SMILES | C/C=C\N=C(C)C.CCCNC(=O)c1cc(C(=O)NC)nc(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C19H23N3O2.C6H11N/c1-4-10-21-18(23)15-11-16(22-17(12-15)19(24)20-3)13(2)14-8-6-5-7-9-14;1-4-5-7-6(2)3/h5-9,11-13H,4,10H2,1-3H3,(H,20,24)(H,21,23);4-5H,1-3H3/b;5-4- |
| InChIKey | PYSRYAGPWJXAQJ-GUHKXDMSSA-N |
| XLogP | 4.73 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|