C31H34N4O6 — CID 145379851
4-N-[3-(1,3-dioxan-2-yl)propyl]-2-N-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide;isoindole-1,3-dione (PubChem CID 145379851) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is 4-N-[3-(1,3-dioxan-2-yl)propyl]-2-N-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide;isoindole-1,3-dione.
| Compound Name | 4-N-[3-(1,3-dioxan-2-yl)propyl]-2-N-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide;isoindole-1,3-dione |
|---|---|
| PubChem CID | 145379851 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 4-N-[3-(1,3-dioxan-2-yl)propyl]-2-N-methyl-6-(1-phenylethyl)pyridine-2,4-dicarboxamide;isoindole-1,3-dione |
| SMILES | CNC(=O)c1cc(C(=O)NCCCC2OCCCO2)cc(C(C)c2ccccc2)n1.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O4.C8H5NO2/c1-16(17-8-4-3-5-9-17)19-14-18(15-20(26-19)23(28)24-2)22(27)25-11-6-10-21-29-12-7-13-30-21;10-7-5-3-1-2-4-6(5)8(11)9-7/h3-5,8-9,14-16,21H,6-7,10-13H2,1-2H3,(H,24,28)(H,25,27);1-4H,(H,9,10,11) |
| InChIKey | OJOQZGAZHJUPCA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|