C32H33N3O6 — CID 160626362
4-[5-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]pentanoyl]-N-methyl-6-[(1S)-1-phenylethyl]pyridine-2-carboxamide (PubChem CID 160626362) has the molecular formula C32H33N3O6 and a molecular weight of 555.63 g/mol. Its IUPAC name is 4-[5-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]pentanoyl]-N-methyl-6-[(1S)-1-phenylethyl]pyridine-2-carboxamide.
| Compound Name | 4-[5-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]pentanoyl]-N-methyl-6-[(1S)-1-phenylethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 160626362 |
| Molecular Formula | C32H33N3O6 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 4-[5-[5-(1,3-dioxoisoindol-2-yl)-1,3-dioxan-2-yl]pentanoyl]-N-methyl-6-[(1S)-1-phenylethyl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(C(=O)CCCCC2OCC(N3C(=O)c4ccccc4C3=O)CO2)cc([C@@H](C)c2ccccc2)n1 |
| InChI | InChI=1S/C32H33N3O6/c1-20(21-10-4-3-5-11-21)26-16-22(17-27(34-26)30(37)33-2)28(36)14-8-9-15-29-40-18-23(19-41-29)35-31(38)24-12-6-7-13-25(24)32(35)39/h3-7,10-13,16-17,20,23,29H,8-9,14-15,18-19H2,1-2H3,(H,33,37)/t20-,23?,29?/m0/s1 |
| InChIKey | RHISPZJBGRRXOF-NNIWKDTMSA-N |
| XLogP | 4.37 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|