C14H16ClN3O — CID 142418090
1-[1-(2-chlorophenyl)ethyl]-N,5-dimethylpyrazole-3-carboxamide (PubChem CID 142418090) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-N,5-dimethylpyrazole-3-carboxamide.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-N,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 142418090 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-N,5-dimethylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1cc(C)n(C(C)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H16ClN3O/c1-9-8-13(14(19)16-3)17-18(9)10(2)11-6-4-5-7-12(11)15/h4-8,10H,1-3H3,(H,16,19) |
| InChIKey | MXZFKAQXRBGYNE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |