C26H26F4N4O2 — CID 142418709
1-[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-2,6-difluorophenyl]-N-methylmethanimine oxide (PubChem CID 142418709) has the molecular formula C26H26F4N4O2 and a molecular weight of 502.51 g/mol. Its IUPAC name is 1-[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-2,6-difluorophenyl]-N-methylmethanimine oxide.
| Compound Name | 1-[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-2,6-difluorophenyl]-N-methylmethanimine oxide |
|---|---|
| PubChem CID | 142418709 |
| Molecular Formula | C26H26F4N4O2 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 1-[4-[4-[[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]methoxy]-3,5-difluorophenyl]-2,6-difluorophenyl]-N-methylmethanimine oxide |
| SMILES | CCc1cnc(N2CCC(COc3c(F)cc(-c4cc(F)c(/C=[N+](/C)[O-])c(F)c4)cc3F)CC2)nc1 |
| InChI | InChI=1S/C26H26F4N4O2/c1-3-16-12-31-26(32-13-16)34-6-4-17(5-7-34)15-36-25-23(29)10-19(11-24(25)30)18-8-21(27)20(14-33(2)35)22(28)9-18/h8-14,17H,3-7,15H2,1-2H3/b33-14- |
| InChIKey | HRXMFMFAUKGFDN-DMWKKASYSA-N |
| XLogP | 5.12 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|