C27H37N3O2 — CID 142419041
(3R)-3-(4-ethylphenyl)-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol (PubChem CID 142419041) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is (3R)-3-(4-ethylphenyl)-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol.
| Compound Name | (3R)-3-(4-ethylphenyl)-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
|---|---|
| PubChem CID | 142419041 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | (3R)-3-(4-ethylphenyl)-3-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]prop-1-en-2-ol |
| SMILES | C=C(O)[C@@H](c1ccc(CC)cc1)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C27H37N3O2/c1-3-21-9-11-22(12-10-21)26(20(2)31)30-17-15-25(19-30)32-18-5-4-8-24-14-13-23-7-6-16-28-27(23)29-24/h9-14,25-26,31H,2-8,15-19H2,1H3,(H,28,29)/t25-,26+/m1/s1 |
| InChIKey | HYVULIQSGCSURD-FTJBHMTQSA-N |
| XLogP | 5.23 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|