C17H20BrF2N3O2S — CID 142420276
N-(3-bromo-4-fluorophenyl)formamide;fluorobenzene;2-methyl-1,2,6-thiadiazinane 1-oxide (PubChem CID 142420276) has the molecular formula C17H20BrF2N3O2S and a molecular weight of 448.33 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)formamide;fluorobenzene;2-methyl-1,2,6-thiadiazinane 1-oxide.
| Compound Name | N-(3-bromo-4-fluorophenyl)formamide;fluorobenzene;2-methyl-1,2,6-thiadiazinane 1-oxide |
|---|---|
| PubChem CID | 142420276 |
| Molecular Formula | C17H20BrF2N3O2S |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)formamide;fluorobenzene;2-methyl-1,2,6-thiadiazinane 1-oxide |
| SMILES | CN1CCCNS1=O.Fc1ccccc1.O=CNc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C7H5BrFNO.C6H5F.C4H10N2OS/c8-6-3-5(10-4-11)1-2-7(6)9;7-6-4-2-1-3-5-6;1-6-4-2-3-5-8(6)7/h1-4H,(H,10,11);1-5H;5H,2-4H2,1H3 |
| InChIKey | GORJYYFSGGGWGG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|