C14H19FN4O2S — CID 144870304
N-[3-(6-amino-2,7,7-trimethyl-1-oxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]formamide (PubChem CID 144870304) has the molecular formula C14H19FN4O2S and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[3-(6-amino-2,7,7-trimethyl-1-oxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]formamide.
| Compound Name | N-[3-(6-amino-2,7,7-trimethyl-1-oxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]formamide |
|---|---|
| PubChem CID | 144870304 |
| Molecular Formula | C14H19FN4O2S |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[3-(6-amino-2,7,7-trimethyl-1-oxo-3,4-dihydro-1,2,5-thiadiazepin-4-yl)-4-fluorophenyl]formamide |
| SMILES | CN1CC(c2cc(NC=O)ccc2F)N=C(N)C(C)(C)S1=O |
| InChI | InChI=1S/C14H19FN4O2S/c1-14(2)13(16)18-12(7-19(3)22(14)21)10-6-9(17-8-20)4-5-11(10)15/h4-6,8,12H,7H2,1-3H3,(H2,16,18)(H,17,20) |
| InChIKey | AJBVAZUPCOMTPS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|