C16H20FN3O2S — CID 130282834
N-[3-(5-amino-1-oxo-1λ4-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide (PubChem CID 130282834) has the molecular formula C16H20FN3O2S and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[3-(5-amino-1-oxo-1λ4-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide.
| Compound Name | N-[3-(5-amino-1-oxo-1λ4-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide |
|---|---|
| PubChem CID | 130282834 |
| Molecular Formula | C16H20FN3O2S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-[3-(5-amino-1-oxo-1λ4-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide |
| SMILES | NC1=NC(c2cc(NC=O)ccc2F)CS(=O)C12CCCCC2 |
| InChI | InChI=1S/C16H20FN3O2S/c17-13-5-4-11(19-10-21)8-12(13)14-9-23(22)16(15(18)20-14)6-2-1-3-7-16/h4-5,8,10,14H,1-3,6-7,9H2,(H2,18,20)(H,19,21) |
| InChIKey | WXMHLSRIZGJDSR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|