C16H28FN3O2S — CID 144606503
3-(5-amino-2-fluorophenyl)-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-5-amine;ethane;methoxymethane (PubChem CID 144606503) has the molecular formula C16H28FN3O2S and a molecular weight of 345.48 g/mol. Its IUPAC name is 3-(5-amino-2-fluorophenyl)-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-5-amine;ethane;methoxymethane.
| Compound Name | 3-(5-amino-2-fluorophenyl)-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-5-amine;ethane;methoxymethane |
|---|---|
| PubChem CID | 144606503 |
| Molecular Formula | C16H28FN3O2S |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-(5-amino-2-fluorophenyl)-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-5-amine;ethane;methoxymethane |
| SMILES | CC.CC1(C)C(N)=NC(c2cc(N)ccc2F)CS1=O.COC |
| InChI | InChI=1S/C12H16FN3OS.C2H6O.C2H6/c1-12(2)11(15)16-10(6-18(12)17)8-5-7(14)3-4-9(8)13;1-3-2;1-2/h3-5,10H,6,14H2,1-2H3,(H2,15,16);1-2H3;1-2H3 |
| InChIKey | XDIXKODNSRRLJL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|