C18H16F4N4O2S — CID 126633940
N-[3-(5-amino-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3,5-difluoropyridine-2-carboxamide (PubChem CID 126633940) has the molecular formula C18H16F4N4O2S and a molecular weight of 428.41 g/mol. Its IUPAC name is N-[3-(5-amino-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3,5-difluoropyridine-2-carboxamide.
| Compound Name | N-[3-(5-amino-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3,5-difluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 126633940 |
| Molecular Formula | C18H16F4N4O2S |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[3-(5-amino-6,6-dimethyl-1-oxo-2,3-dihydro-1,4-thiazin-3-yl)-4,5-difluorophenyl]-3,5-difluoropyridine-2-carboxamide |
| SMILES | CC1(C)C(N)=NC(c2cc(NC(=O)c3ncc(F)cc3F)cc(F)c2F)CS1=O |
| InChI | InChI=1S/C18H16F4N4O2S/c1-18(2)17(23)26-13(7-29(18)28)10-4-9(5-11(20)14(10)22)25-16(27)15-12(21)3-8(19)6-24-15/h3-6,13H,7H2,1-2H3,(H2,23,26)(H,25,27) |
| InChIKey | IYEIQNSHYLRBIJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |