About N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide
N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide (PubChem CID 130283816) has the molecular formula C16H20FN3O3S
and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide.
Molecular Properties
| Compound Name | N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide |
| PubChem CID | 130283816 |
| Molecular Formula | C16H20FN3O3S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide |
| SMILES | NC1=NC(c2cc(NC=O)ccc2F)CS(=O)(=O)C12CCCCC2 |
| InChI | InChI=1S/C16H20FN3O3S/c17-13-5-4-11(19-10-21)8-12(13)14-9-24(22,23)16(15(18)20-14)6-2-1-3-7-16/h4-5,8,10,14H,1-3,6-7,9H2,(H2,18,20)(H,19,21) |
| InChIKey | ULJCTBJEXQVTAF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide?
The IUPAC name of N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide (CID 130283816) is N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide.
What is the SMILES notation for N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide?
The canonical SMILES for N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide is NC1=NC(c2cc(NC=O)ccc2F)CS(=O)(=O)C12CCCCC2.
What is the InChIKey of N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide?
The InChIKey is ULJCTBJEXQVTAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FN3O3S/c17-13-5-4-11(19-10-21)8-12(13)14-9-24(22,23)16(15(18)20-14)6-2-1-3-7-16/h4-5,8,10,14H,1-3,6-7,9H2,(H2,18,20)(H,19,21).
What are the key properties of N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide?
N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide has a molecular weight of 353.42 g/mol, XLogP of 1.92, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5-amino-1,1-dioxo-1λ6-thia-4-azaspiro[5.5]undec-4-en-3-yl)-4-fluorophenyl]formamide is sourced from PubChem (CID 130283816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).