C21H24F3N5O — CID 144615675
N-[3-[(2R)-6-amino-2-prop-1-en-2-yl-4,5-dihydro-3H-pyridin-2-yl]-4-fluorophenyl]formamide;2-(difluoromethyl)-5-methylpyrazine (PubChem CID 144615675) has the molecular formula C21H24F3N5O and a molecular weight of 419.45 g/mol. Its IUPAC name is N-[3-[(2R)-6-amino-2-prop-1-en-2-yl-4,5-dihydro-3H-pyridin-2-yl]-4-fluorophenyl]formamide;2-(difluoromethyl)-5-methylpyrazine.
| Compound Name | N-[3-[(2R)-6-amino-2-prop-1-en-2-yl-4,5-dihydro-3H-pyridin-2-yl]-4-fluorophenyl]formamide;2-(difluoromethyl)-5-methylpyrazine |
|---|---|
| PubChem CID | 144615675 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[3-[(2R)-6-amino-2-prop-1-en-2-yl-4,5-dihydro-3H-pyridin-2-yl]-4-fluorophenyl]formamide;2-(difluoromethyl)-5-methylpyrazine |
| SMILES | C=C(C)[C@@]1(c2cc(NC=O)ccc2F)CCCC(N)=N1.Cc1cnc(C(F)F)cn1 |
| InChI | InChI=1S/C15H18FN3O.C6H6F2N2/c1-10(2)15(7-3-4-14(17)19-15)12-8-11(18-9-20)5-6-13(12)16;1-4-2-10-5(3-9-4)6(7)8/h5-6,8-9H,1,3-4,7H2,2H3,(H2,17,19)(H,18,20);2-3,6H,1H3/t15-;/m1./s1 |
| InChIKey | LNVWPWSXTNCXGL-XFULWGLBSA-N |
| XLogP | 4.43 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|