About N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine
N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine (PubChem CID 142421723) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine.
Molecular Properties
| Compound Name | N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine |
| PubChem CID | 142421723 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine |
| SMILES | C=N/C=C(/F)C(=C)C(C)(C)C |
| InChI | InChI=1S/C9H14FN/c1-7(9(2,3)4)8(10)6-11-5/h6H,1,5H2,2-4H3/b8-6+ |
| InChIKey | KXFCMTLJRRHFGY-SOFGYWHQSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine?
The IUPAC name of N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine (CID 142421723) is N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine.
What is the SMILES notation for N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine?
The canonical SMILES for N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine is C=N/C=C(/F)C(=C)C(C)(C)C.
What is the InChIKey of N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine?
The InChIKey is KXFCMTLJRRHFGY-SOFGYWHQSA-N. The full InChI is InChI=1S/C9H14FN/c1-7(9(2,3)4)8(10)6-11-5/h6H,1,5H2,2-4H3/b8-6+.
What are the key properties of N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine?
N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine has a molecular weight of 155.22 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-2-fluoro-4,4-dimethyl-3-methylidenepent-1-enyl]methanimine is sourced from PubChem (CID 142421723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).