C8H14FN — CID 144746713
ethane;N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]methanimine (PubChem CID 144746713) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is ethane;N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]methanimine.
| Compound Name | ethane;N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 144746713 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | ethane;N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(/F)C(=C)C.CC |
| InChI | InChI=1S/C6H8FN.C2H6/c1-5(2)6(7)4-8-3;1-2/h4H,1,3H2,2H3;1-2H3/b6-4+; |
| InChIKey | UMOMFASTDBVQAP-CVDVRWGVSA-N |
| XLogP | 3.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|