About 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine
3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine (PubChem CID 142422469) has the molecular formula C11H14FN3O
and a molecular weight of 223.25 g/mol. Its IUPAC name is 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine.
Molecular Properties
| Compound Name | 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine |
| PubChem CID | 142422469 |
| Molecular Formula | C11H14FN3O |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine |
| SMILES | C=NO.Fc1ccnc(N2CC3CC3C2)c1 |
| InChI | InChI=1S/C10H11FN2.CH3NO/c11-9-1-2-12-10(4-9)13-5-7-3-8(7)6-13;1-2-3/h1-2,4,7-8H,3,5-6H2;3H,1H2 |
| InChIKey | CEAZZSVOQKJZGO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine?
The IUPAC name of 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine (CID 142422469) is 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine.
What is the SMILES notation for 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine?
The canonical SMILES for 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine is C=NO.Fc1ccnc(N2CC3CC3C2)c1.
What is the InChIKey of 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine?
The InChIKey is CEAZZSVOQKJZGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2.CH3NO/c11-9-1-2-12-10(4-9)13-5-7-3-8(7)6-13;1-2-3/h1-2,4,7-8H,3,5-6H2;3H,1H2.
What are the key properties of 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine?
3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine has a molecular weight of 223.25 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluoro-2-pyridinyl)-3-azabicyclo[3.1.0]hexane;N-methylidenehydroxylamine is sourced from PubChem (CID 142422469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).