C10H13N3 — CID 130140544
2-(3-azabicyclo[3.1.0]hexan-3-yl)pyridin-4-amine (PubChem CID 130140544) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 2-(3-azabicyclo[3.1.0]hexan-3-yl)pyridin-4-amine.
| Compound Name | 2-(3-azabicyclo[3.1.0]hexan-3-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 130140544 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-(3-azabicyclo[3.1.0]hexan-3-yl)pyridin-4-amine |
| SMILES | Nc1ccnc(N2CC3CC3C2)c1 |
| InChI | InChI=1S/C10H13N3/c11-9-1-2-12-10(4-9)13-5-7-3-8(7)6-13/h1-2,4,7-8H,3,5-6H2,(H2,11,12) |
| InChIKey | DCXNKEAYYFGNRB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |