C10H14N4 — CID 130979615
[4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]hydrazine (PubChem CID 130979615) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is [4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]hydrazine.
| Compound Name | [4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 130979615 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | [4-(3-azabicyclo[3.1.0]hexan-3-yl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(N2CC3CC3C2)ccn1 |
| InChI | InChI=1S/C10H14N4/c11-13-10-4-9(1-2-12-10)14-5-7-3-8(7)6-14/h1-2,4,7-8H,3,5-6,11H2,(H,12,13) |
| InChIKey | AFZKNWNOARWSME-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|