C15H14N2O2 — CID 164533157
6-(3-azabicyclo[3.1.0]hexan-3-yl)quinoline-4-carboxylic acid (PubChem CID 164533157) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-(3-azabicyclo[3.1.0]hexan-3-yl)quinoline-4-carboxylic acid.
| Compound Name | 6-(3-azabicyclo[3.1.0]hexan-3-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 164533157 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 6-(3-azabicyclo[3.1.0]hexan-3-yl)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc2ccc(N3CC4CC4C3)cc12 |
| InChI | InChI=1S/C15H14N2O2/c18-15(19)12-3-4-16-14-2-1-11(6-13(12)14)17-7-9-5-10(9)8-17/h1-4,6,9-10H,5,7-8H2,(H,18,19) |
| InChIKey | UEGIFZMRBFZBDN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |