C18H20N2O4 — CID 164533139
6-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)quinoline-4-carboxylic acid (PubChem CID 164533139) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 6-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)quinoline-4-carboxylic acid.
| Compound Name | 6-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 164533139 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 6-(1,5-dioxa-9-azaspiro[5.5]undecan-9-yl)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc2ccc(N3CCC4(CC3)OCCCO4)cc12 |
| InChI | InChI=1S/C18H20N2O4/c21-17(22)14-4-7-19-16-3-2-13(12-15(14)16)20-8-5-18(6-9-20)23-10-1-11-24-18/h2-4,7,12H,1,5-6,8-11H2,(H,21,22) |
| InChIKey | GHAQJZWOKALTCW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |