C15H17ClN2O3 — CID 175744986
6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]quinoline-4-carboxylic acid;hydrochloride (PubChem CID 175744986) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is 6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]quinoline-4-carboxylic acid;hydrochloride.
| Compound Name | 6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]quinoline-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 175744986 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]quinoline-4-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccnc2ccc(N3CC[C@@H](CO)C3)cc12 |
| InChI | InChI=1S/C15H16N2O3.ClH/c18-9-10-4-6-17(8-10)11-1-2-14-13(7-11)12(15(19)20)3-5-16-14;/h1-3,5,7,10,18H,4,6,8-9H2,(H,19,20);1H/t10-;/m1./s1 |
| InChIKey | JQFNRYMDTDWXJU-HNCPQSOCSA-N |
| XLogP | 2.17 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |