C10H15N3O2 — CID 106667686
1-[2-(aminomethyl)-4-pyridinyl]pyrrolidine-3,4-diol (PubChem CID 106667686) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-4-pyridinyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[2-(aminomethyl)-4-pyridinyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667686 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-[2-(aminomethyl)-4-pyridinyl]pyrrolidine-3,4-diol |
| SMILES | NCc1cc(N2CC(O)C(O)C2)ccn1 |
| InChI | InChI=1S/C10H15N3O2/c11-4-7-3-8(1-2-12-7)13-5-9(14)10(15)6-13/h1-3,9-10,14-15H,4-6,11H2 |
| InChIKey | GEZYXBMYCGQBCW-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |