C21H22N6O2 — CID 142423967
2-[[(3-amino-2-methoxyprop-2-enylidene)amino]methyl]-1-(oxan-4-yl)imidazo[4,5-c]quinoline-8-carbonitrile (PubChem CID 142423967) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 2-[[(3-amino-2-methoxyprop-2-enylidene)amino]methyl]-1-(oxan-4-yl)imidazo[4,5-c]quinoline-8-carbonitrile.
| Compound Name | 2-[[(3-amino-2-methoxyprop-2-enylidene)amino]methyl]-1-(oxan-4-yl)imidazo[4,5-c]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 142423967 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-[[(3-amino-2-methoxyprop-2-enylidene)amino]methyl]-1-(oxan-4-yl)imidazo[4,5-c]quinoline-8-carbonitrile |
| SMILES | COC(=CN)/C=N/Cc1nc2cnc3ccc(C#N)cc3c2n1C1CCOCC1 |
| InChI | InChI=1S/C21H22N6O2/c1-28-16(10-23)11-24-13-20-26-19-12-25-18-3-2-14(9-22)8-17(18)21(19)27(20)15-4-6-29-7-5-15/h2-3,8,10-12,15H,4-7,13,23H2,1H3/b16-10?,24-11+ |
| InChIKey | LYLDDTXTXOSKGD-DBFOPBFPSA-N |
| XLogP | 2.82 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|