C17H18N6O — CID 176652177
2-hydrazinyl-1-[(2R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile (PubChem CID 176652177) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-hydrazinyl-1-[(2R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile.
| Compound Name | 2-hydrazinyl-1-[(2R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 176652177 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-hydrazinyl-1-[(2R)-2-methyloxan-4-yl]imidazo[4,5-c]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CC(n2c(NN)nc3cnc4ccc(C#N)cc4c32)CCO1 |
| InChI | InChI=1S/C17H18N6O/c1-10-6-12(4-5-24-10)23-16-13-7-11(8-18)2-3-14(13)20-9-15(16)21-17(23)22-19/h2-3,7,9-10,12H,4-6,19H2,1H3,(H,21,22)/t10-,12?/m1/s1 |
| InChIKey | FYUKVCDATKEYAW-RWANSRKNSA-N |
| XLogP | 2.48 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|