About 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole
5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole (PubChem CID 142423988) has the molecular formula C27H25F3N2S
and a molecular weight of 466.57 g/mol. Its IUPAC name is 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole.
Molecular Properties
| Compound Name | 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole |
| PubChem CID | 142423988 |
| Molecular Formula | C27H25F3N2S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole |
| SMILES | Cn1nccc1-c1cccc(C(F)(F)F)c1.c1ccc(CSc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C16H16S.C11H9F3N2/c1-2-5-13(6-3-1)12-17-16-10-9-14-7-4-8-15(14)11-16;1-16-10(5-6-15-16)8-3-2-4-9(7-8)11(12,13)14/h1-3,5-6,9-11H,4,7-8,12H2;2-7H,1H3 |
| InChIKey | CFRQRRWPXGBLDH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole?
The IUPAC name of 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole (CID 142423988) is 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole.
What is the SMILES notation for 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole?
The canonical SMILES for 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole is Cn1nccc1-c1cccc(C(F)(F)F)c1.c1ccc(CSc2ccc3c(c2)CCC3)cc1.
What is the InChIKey of 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole?
The InChIKey is CFRQRRWPXGBLDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16S.C11H9F3N2/c1-2-5-13(6-3-1)12-17-16-10-9-14-7-4-8-15(14)11-16;1-16-10(5-6-15-16)8-3-2-4-9(7-8)11(12,13)14/h1-3,5-6,9-11H,4,7-8,12H2;2-7H,1H3.
What are the key properties of 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole?
5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole has a molecular weight of 466.57 g/mol, XLogP of 7.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylsulfanyl-2,3-dihydro-1H-indene;1-methyl-5-[3-(trifluoromethyl)phenyl]pyrazole is sourced from PubChem (CID 142423988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).