C13H14N2 — CID 116869108
5-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole (PubChem CID 116869108) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole |
|---|---|
| PubChem CID | 116869108 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-1-methylpyrazole |
| SMILES | Cn1nccc1-c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C13H14N2/c1-15-13(7-8-14-15)12-6-5-10-3-2-4-11(10)9-12/h5-9H,2-4H2,1H3 |
| InChIKey | REBYMASPAQXNFS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |