C51H38N2 — CID 142425044
7-[4-[4-[4-[amino(diphenyl)methyl]phenyl]naphthalen-1-yl]phenyl]-9,9-dimethylfluorene-2-carbonitrile (PubChem CID 142425044) has the molecular formula C51H38N2 and a molecular weight of 678.88 g/mol. Its IUPAC name is 7-[4-[4-[4-[amino(diphenyl)methyl]phenyl]naphthalen-1-yl]phenyl]-9,9-dimethylfluorene-2-carbonitrile.
| Compound Name | 7-[4-[4-[4-[amino(diphenyl)methyl]phenyl]naphthalen-1-yl]phenyl]-9,9-dimethylfluorene-2-carbonitrile |
|---|---|
| PubChem CID | 142425044 |
| Molecular Formula | C51H38N2 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.30 |
| IUPAC Name | 7-[4-[4-[4-[amino(diphenyl)methyl]phenyl]naphthalen-1-yl]phenyl]-9,9-dimethylfluorene-2-carbonitrile |
| SMILES | CC1(C)c2cc(C#N)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(C(N)(c6ccccc6)c6ccccc6)cc5)c5ccccc45)cc3)cc21 |
| InChI | InChI=1S/C51H38N2/c1-50(2)48-31-34(33-52)17-27-46(48)47-28-24-38(32-49(47)50)35-18-20-36(21-19-35)42-29-30-43(45-16-10-9-15-44(42)45)37-22-25-41(26-23-37)51(53,39-11-5-3-6-12-39)40-13-7-4-8-14-40/h3-32H,53H2,1-2H3 |
| InChIKey | LNYCLKQPZGEAIC-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|