C25H42O2 — CID 142425451
(4E)-4-(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)butanoic acid;ethane (PubChem CID 142425451) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (4E)-4-(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)butanoic acid;ethane.
| Compound Name | (4E)-4-(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)butanoic acid;ethane |
|---|---|
| PubChem CID | 142425451 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (4E)-4-(10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-ylidene)butanoic acid;ethane |
| SMILES | CC.CC12CCC3C(CCC4CCCCC43C)C1CC/C2=C\CCC(=O)O |
| InChI | InChI=1S/C23H36O2.C2H6/c1-22-14-4-3-6-16(22)9-11-18-19-12-10-17(7-5-8-21(24)25)23(19,2)15-13-20(18)22;1-2/h7,16,18-20H,3-6,8-15H2,1-2H3,(H,24,25);1-2H3/b17-7+; |
| InChIKey | VJVOILSWBSFIRY-VYYXIRCESA-N |
| XLogP | 7.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|