C19H32O3 — CID 122398799
3-[(1S,2S,4aS,4bS,8aR,10aR)-2-hydroxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanoic acid (PubChem CID 122398799) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 3-[(1S,2S,4aS,4bS,8aR,10aR)-2-hydroxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanoic acid.
| Compound Name | 3-[(1S,2S,4aS,4bS,8aR,10aR)-2-hydroxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanoic acid |
|---|---|
| PubChem CID | 122398799 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 3-[(1S,2S,4aS,4bS,8aR,10aR)-2-hydroxy-2,4b-dimethyl-1,3,4,4a,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]propanoic acid |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@@H]1[C@@H]2CC[C@](C)(O)[C@H]1CCC(=O)O |
| InChI | InChI=1S/C19H32O3/c1-18-11-4-3-5-13(18)6-7-14-15(18)10-12-19(2,22)16(14)8-9-17(20)21/h13-16,22H,3-12H2,1-2H3,(H,20,21)/t13-,14-,15+,16+,18+,19+/m1/s1 |
| InChIKey | SDEUQSOWTDVHAG-WDDLDYLJSA-N |
| XLogP | 4.23 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |