C14H17N7 — CID 142425609
5-[amino-[(Z)-aminodiazenyl]methyl]-N-(1-phenylcyclopropyl)pyrimidin-2-amine (PubChem CID 142425609) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is 5-[amino-[(Z)-aminodiazenyl]methyl]-N-(1-phenylcyclopropyl)pyrimidin-2-amine.
| Compound Name | 5-[amino-[(Z)-aminodiazenyl]methyl]-N-(1-phenylcyclopropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 142425609 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 5-[amino-[(Z)-aminodiazenyl]methyl]-N-(1-phenylcyclopropyl)pyrimidin-2-amine |
| SMILES | N/N=N\C(N)c1cnc(NC2(c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C14H17N7/c15-12(20-21-16)10-8-17-13(18-9-10)19-14(6-7-14)11-4-2-1-3-5-11/h1-5,8-9,12H,6-7,15H2,(H2,16,20)(H,17,18,19) |
| InChIKey | DIGKZGFTWJUYPD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|