About methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine
methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine (PubChem CID 142425676) has the molecular formula C12H21NOS
and a molecular weight of 227.37 g/mol. Its IUPAC name is methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine.
Molecular Properties
| Compound Name | methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine |
| PubChem CID | 142425676 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine |
| SMILES | CO.CSNCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C11H17NS.CH4O/c1-9(2)11-6-4-10(5-7-11)8-12-13-3;1-2/h4-7,9,12H,8H2,1-3H3;2H,1H3 |
| InChIKey | ZTYPNTRYZJYJGW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine?
The IUPAC name of methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine (CID 142425676) is methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine.
What is the SMILES notation for methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine?
The canonical SMILES for methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine is CO.CSNCc1ccc(C(C)C)cc1.
What is the InChIKey of methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine?
The InChIKey is ZTYPNTRYZJYJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NS.CH4O/c1-9(2)11-6-4-10(5-7-11)8-12-13-3;1-2/h4-7,9,12H,8H2,1-3H3;2H,1H3.
What are the key properties of methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine?
methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine has a molecular weight of 227.37 g/mol, XLogP of 2.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;N-methylsulfanyl-1-(4-propan-2-ylphenyl)methanamine is sourced from PubChem (CID 142425676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).