C19H27F3N8O2S — CID 142425704
N,N'-diamino-2-[[2-(cyclopropylsulfinylamino)-1-[4-(difluoromethoxy)-2-fluorophenyl]ethyl]amino]pyrimidine-5-carboximidamide;ethane (PubChem CID 142425704) has the molecular formula C19H27F3N8O2S and a molecular weight of 488.54 g/mol. Its IUPAC name is N,N'-diamino-2-[[2-(cyclopropylsulfinylamino)-1-[4-(difluoromethoxy)-2-fluorophenyl]ethyl]amino]pyrimidine-5-carboximidamide;ethane.
| Compound Name | N,N'-diamino-2-[[2-(cyclopropylsulfinylamino)-1-[4-(difluoromethoxy)-2-fluorophenyl]ethyl]amino]pyrimidine-5-carboximidamide;ethane |
|---|---|
| PubChem CID | 142425704 |
| Molecular Formula | C19H27F3N8O2S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N,N'-diamino-2-[[2-(cyclopropylsulfinylamino)-1-[4-(difluoromethoxy)-2-fluorophenyl]ethyl]amino]pyrimidine-5-carboximidamide;ethane |
| SMILES | CC.N/N=C(\NN)c1cnc(NC(CNS(=O)C2CC2)c2ccc(OC(F)F)cc2F)nc1 |
| InChI | InChI=1S/C17H21F3N8O2S.C2H6/c18-13-5-10(30-16(19)20)1-4-12(13)14(8-25-31(29)11-2-3-11)26-17-23-6-9(7-24-17)15(27-21)28-22;1-2/h1,4-7,11,14,16,25H,2-3,8,21-22H2,(H,27,28)(H,23,24,26);1-2H3 |
| InChIKey | BGDMMNOTSRRJTN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 152.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|