C18H28FN7 — CID 142425626
N,N'-diamino-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pyrimidine-5-carboximidamide;ethane (PubChem CID 142425626) has the molecular formula C18H28FN7 and a molecular weight of 361.47 g/mol. Its IUPAC name is N,N'-diamino-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pyrimidine-5-carboximidamide;ethane.
| Compound Name | N,N'-diamino-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pyrimidine-5-carboximidamide;ethane |
|---|---|
| PubChem CID | 142425626 |
| Molecular Formula | C18H28FN7 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | N,N'-diamino-2-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pyrimidine-5-carboximidamide;ethane |
| SMILES | CC.CC.N/N=C(\NN)c1cnc(NC2CCc3cc(F)ccc32)nc1 |
| InChI | InChI=1S/C14H16FN7.2C2H6/c15-10-2-3-11-8(5-10)1-4-12(11)20-14-18-6-9(7-19-14)13(21-16)22-17;2*1-2/h2-3,5-7,12H,1,4,16-17H2,(H,21,22)(H,18,19,20);2*1-2H3 |
| InChIKey | AFBKPFWIMIBTKD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|