C19H21FN2O — CID 142425851
ethane;N-ethyl-5-(4-fluorophenyl)-1H-indole-3-carboxamide (PubChem CID 142425851) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is ethane;N-ethyl-5-(4-fluorophenyl)-1H-indole-3-carboxamide.
| Compound Name | ethane;N-ethyl-5-(4-fluorophenyl)-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 142425851 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | ethane;N-ethyl-5-(4-fluorophenyl)-1H-indole-3-carboxamide |
| SMILES | CC.CCNC(=O)c1c[nH]c2ccc(-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C17H15FN2O.C2H6/c1-2-19-17(21)15-10-20-16-8-5-12(9-14(15)16)11-3-6-13(18)7-4-11;1-2/h3-10,20H,2H2,1H3,(H,19,21);1-2H3 |
| InChIKey | ZZLCVHNEYPKKCC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |