C12H26N2 — CID 142426595
ethane;1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine (PubChem CID 142426595) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is ethane;1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine.
| Compound Name | ethane;1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine |
|---|---|
| PubChem CID | 142426595 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | ethane;1-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-2-amine |
| SMILES | CC.CN1C(N)CCC2CCCCC21 |
| InChI | InChI=1S/C10H20N2.C2H6/c1-12-9-5-3-2-4-8(9)6-7-10(12)11;1-2/h8-10H,2-7,11H2,1H3;1-2H3 |
| InChIKey | MXKCOCMZSFVQFG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |